C23H30N4O3 — CID 159972665
(4-phenylphenyl)methyl (2S)-7-amino-2-[[(2S)-2-aminopropanoyl]amino]-7-iminoheptanoate (PubChem CID 159972665) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is (4-phenylphenyl)methyl (2S)-7-amino-2-[[(2S)-2-aminopropanoyl]amino]-7-iminoheptanoate.
| Compound Name | (4-phenylphenyl)methyl (2S)-7-amino-2-[[(2S)-2-aminopropanoyl]amino]-7-iminoheptanoate |
|---|---|
| PubChem CID | 159972665 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (4-phenylphenyl)methyl (2S)-7-amino-2-[[(2S)-2-aminopropanoyl]amino]-7-iminoheptanoate |
| SMILES | [H]/N=C(\N)CCCC[C@H](NC(=O)[C@H](C)N)C(=O)OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-16(24)22(28)27-20(9-5-6-10-21(25)26)23(29)30-15-17-11-13-19(14-12-17)18-7-3-2-4-8-18/h2-4,7-8,11-14,16,20H,5-6,9-10,15,24H2,1H3,(H3,25,26)(H,27,28)/t16-,20-/m0/s1 |
| InChIKey | RBJYLFVOCFMULL-JXFKEZNVSA-N |
| XLogP | 2.73 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|