C18H23ClNO+ — CID 38988829
2-[(1S)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl-dimethylazanium (PubChem CID 38988829) has the molecular formula C18H23ClNO+ and a molecular weight of 304.84 g/mol. Its IUPAC name is 2-[(1S)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl-dimethylazanium.
| Compound Name | 2-[(1S)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 38988829 |
| Molecular Formula | C18H23ClNO+ |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[(1S)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCO[C@@](C)(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClNO/c1-18(21-14-13-20(2)3,15-7-5-4-6-8-15)16-9-11-17(19)12-10-16/h4-12H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
| InChIKey | KKHPNPMTPORSQE-SFHVURJKSA-O |
| XLogP | 2.76 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |