C21H26ClNO — CID 91433359
(2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-2-deuterio-1-methylpyrrolidine (PubChem CID 91433359) has the molecular formula C21H26ClNO and a molecular weight of 344.90 g/mol. Its IUPAC name is (2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-2-deuterio-1-methylpyrrolidine.
| Compound Name | (2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-2-deuterio-1-methylpyrrolidine |
|---|---|
| PubChem CID | 91433359 |
| Molecular Formula | C21H26ClNO |
| Molecular Weight | 344.90 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-2-deuterio-1-methylpyrrolidine |
| SMILES | [2H][C@]1(CCO[C@](C)(c2ccccc2)c2ccc(Cl)cc2)CCCN1C |
| InChI | InChI=1S/C21H26ClNO/c1-21(17-7-4-3-5-8-17,18-10-12-19(22)13-11-18)24-16-14-20-9-6-15-23(20)2/h3-5,7-8,10-13,20H,6,9,14-16H2,1-2H3/t20-,21-/m1/s1/i20D |
| InChIKey | YNNUSGIPVFPVBX-YDDRAIKYSA-N |
| XLogP | 5.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |