C29H29ClNO4P — CID 91470329
2-[1-(4-chlorophenyl)-1-phenylethoxy]-N-diphenoxyphosphoryl-N-methylethanamine (PubChem CID 91470329) has the molecular formula C29H29ClNO4P and a molecular weight of 521.98 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-1-phenylethoxy]-N-diphenoxyphosphoryl-N-methylethanamine.
| Compound Name | 2-[1-(4-chlorophenyl)-1-phenylethoxy]-N-diphenoxyphosphoryl-N-methylethanamine |
|---|---|
| PubChem CID | 91470329 |
| Molecular Formula | C29H29ClNO4P |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-1-phenylethoxy]-N-diphenoxyphosphoryl-N-methylethanamine |
| SMILES | CN(CCOC(C)(c1ccccc1)c1ccc(Cl)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C29H29ClNO4P/c1-29(24-12-6-3-7-13-24,25-18-20-26(30)21-19-25)33-23-22-31(2)36(32,34-27-14-8-4-9-15-27)35-28-16-10-5-11-17-28/h3-21H,22-23H2,1-2H3 |
| InChIKey | SLIZZDCZFUAOGY-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|