C28H29N2O4P — CID 91056343
N-diphenoxyphosphoryl-N-methyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine (PubChem CID 91056343) has the molecular formula C28H29N2O4P and a molecular weight of 488.52 g/mol. Its IUPAC name is N-diphenoxyphosphoryl-N-methyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine.
| Compound Name | N-diphenoxyphosphoryl-N-methyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine |
|---|---|
| PubChem CID | 91056343 |
| Molecular Formula | C28H29N2O4P |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-diphenoxyphosphoryl-N-methyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine |
| SMILES | CN(CCOC(C)(c1ccccc1)c1ccccn1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C28H29N2O4P/c1-28(24-14-6-3-7-15-24,27-20-12-13-21-29-27)32-23-22-30(2)35(31,33-25-16-8-4-9-17-25)34-26-18-10-5-11-19-26/h3-21H,22-23H2,1-2H3 |
| InChIKey | VGLQOZNTVJLFBV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|