C19H23ClNO2+ — CID 53446850
2-(2,3-diphenylprop-2-enoyloxy)ethyl-dimethylazanium;hydrochloride (PubChem CID 53446850) has the molecular formula C19H23ClNO2+ and a molecular weight of 332.85 g/mol. Its IUPAC name is 2-(2,3-diphenylprop-2-enoyloxy)ethyl-dimethylazanium;hydrochloride.
| Compound Name | 2-(2,3-diphenylprop-2-enoyloxy)ethyl-dimethylazanium;hydrochloride |
|---|---|
| PubChem CID | 53446850 |
| Molecular Formula | C19H23ClNO2+ |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-(2,3-diphenylprop-2-enoyloxy)ethyl-dimethylazanium;hydrochloride |
| SMILES | C[NH+](C)CCOC(=O)C(=Cc1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H21NO2.ClH/c1-20(2)13-14-22-19(21)18(17-11-7-4-8-12-17)15-16-9-5-3-6-10-16;/h3-12,15H,13-14H2,1-2H3;1H/p+1 |
| InChIKey | LDLLSTPOHHXBIK-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|