C23H29N2O4+ — CID 4652414
2-[2-benzamido-3-(4-propan-2-yloxyphenyl)prop-2-enoyl]oxyethyl-dimethylazanium (PubChem CID 4652414) has the molecular formula C23H29N2O4+ and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[2-benzamido-3-(4-propan-2-yloxyphenyl)prop-2-enoyl]oxyethyl-dimethylazanium.
| Compound Name | 2-[2-benzamido-3-(4-propan-2-yloxyphenyl)prop-2-enoyl]oxyethyl-dimethylazanium |
|---|---|
| PubChem CID | 4652414 |
| Molecular Formula | C23H29N2O4+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-[2-benzamido-3-(4-propan-2-yloxyphenyl)prop-2-enoyl]oxyethyl-dimethylazanium |
| SMILES | CC(C)Oc1ccc(C=C(NC(=O)c2ccccc2)C(=O)OCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-17(2)29-20-12-10-18(11-13-20)16-21(23(27)28-15-14-25(3)4)24-22(26)19-8-6-5-7-9-19/h5-13,16-17H,14-15H2,1-4H3,(H,24,26)/p+1 |
| InChIKey | TZFWWIRHRRIGBZ-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|