C20H24ClNO3 — CID 170549723
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-(2-phenylphenyl)acetate chloride (PubChem CID 170549723) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-(2-phenylphenyl)acetate chloride.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-(2-phenylphenyl)acetate chloride |
|---|---|
| PubChem CID | 170549723 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-(2-phenylphenyl)acetate chloride |
| SMILES | C[N+]1(C)CCC(OC(=O)C(O)c2ccccc2-c2ccccc2)C1.[Cl-] |
| InChI | InChI=1S/C20H24NO3.ClH/c1-21(2)13-12-16(14-21)24-20(23)19(22)18-11-7-6-10-17(18)15-8-4-3-5-9-15;/h3-11,16,19,22H,12-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZFFSWQPQHHTITR-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|