C19H28NO3+ — CID 142745525
(1,1-dimethylpyrrolidin-1-ium-2-yl) 2-(2-cyclopentylphenyl)-2-hydroxyacetate (PubChem CID 142745525) has the molecular formula C19H28NO3+ and a molecular weight of 318.44 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-2-yl) 2-(2-cyclopentylphenyl)-2-hydroxyacetate.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-2-yl) 2-(2-cyclopentylphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 142745525 |
| Molecular Formula | C19H28NO3+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-2-yl) 2-(2-cyclopentylphenyl)-2-hydroxyacetate |
| SMILES | C[N+]1(C)CCCC1OC(=O)C(O)c1ccccc1C1CCCC1 |
| InChI | InChI=1S/C19H28NO3/c1-20(2)13-7-12-17(20)23-19(22)18(21)16-11-6-5-10-15(16)14-8-3-4-9-14/h5-6,10-11,14,17-18,21H,3-4,7-9,12-13H2,1-2H3/q+1 |
| InChIKey | AMHOHFUUMWOEHP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|