C22H32BrNO5 — CID 118365534
ethyl 2-[1-[(2R)-2-(2-cyclopentylphenyl)-2-hydroxyacetyl]oxypyrrolidin-1-ium-1-yl]propanoate bromide (PubChem CID 118365534) has the molecular formula C22H32BrNO5 and a molecular weight of 470.40 g/mol. Its IUPAC name is ethyl 2-[1-[(2R)-2-(2-cyclopentylphenyl)-2-hydroxyacetyl]oxypyrrolidin-1-ium-1-yl]propanoate bromide.
| Compound Name | ethyl 2-[1-[(2R)-2-(2-cyclopentylphenyl)-2-hydroxyacetyl]oxypyrrolidin-1-ium-1-yl]propanoate bromide |
|---|---|
| PubChem CID | 118365534 |
| Molecular Formula | C22H32BrNO5 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | ethyl 2-[1-[(2R)-2-(2-cyclopentylphenyl)-2-hydroxyacetyl]oxypyrrolidin-1-ium-1-yl]propanoate bromide |
| SMILES | CCOC(=O)C(C)[N+]1(OC(=O)[C@H](O)c2ccccc2C2CCCC2)CCCC1.[Br-] |
| InChI | InChI=1S/C22H32NO5.BrH/c1-3-27-21(25)16(2)23(14-8-9-15-23)28-22(26)20(24)19-13-7-6-12-18(19)17-10-4-5-11-17;/h6-7,12-13,16-17,20,24H,3-5,8-11,14-15H2,1-2H3;1H/q+1;/p-1/t16?,20-;/m1./s1 |
| InChIKey | KNCVYZDDEKOHLB-ALAWQYECSA-M |
| XLogP | 0.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|