C27H35BrN2O4 — CID 87395319
[(3R)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide (PubChem CID 87395319) has the molecular formula C27H35BrN2O4 and a molecular weight of 531.49 g/mol. Its IUPAC name is [(3R)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide.
| Compound Name | [(3R)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide |
|---|---|
| PubChem CID | 87395319 |
| Molecular Formula | C27H35BrN2O4 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [(3R)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate bromide |
| SMILES | CC(C)(C)OC(=O)C[N+]12CCC(CC1)[C@@H](OC(=O)C(Nc1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C27H35N2O4.BrH/c1-27(2,3)33-24(30)19-29-16-14-20(15-17-29)23(18-29)32-26(31)25(21-10-6-4-7-11-21)28-22-12-8-5-9-13-22;/h4-13,20,23,25,28H,14-19H2,1-3H3;1H/q+1;/p-1/t20?,23-,25?,29?;/m0./s1 |
| InChIKey | HCAVFTGJHPSLBY-NHTHKYHRSA-M |
| XLogP | 1.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|