C26H31NO3 — CID 67886001
[1-(cyclohexanecarbonyl)piperidin-4-yl] 2,2-diphenylacetate (PubChem CID 67886001) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is [1-(cyclohexanecarbonyl)piperidin-4-yl] 2,2-diphenylacetate.
| Compound Name | [1-(cyclohexanecarbonyl)piperidin-4-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 67886001 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | [1-(cyclohexanecarbonyl)piperidin-4-yl] 2,2-diphenylacetate |
| SMILES | O=C(OC1CCN(C(=O)C2CCCCC2)CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31NO3/c28-25(22-14-8-3-9-15-22)27-18-16-23(17-19-27)30-26(29)24(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-2,4-7,10-13,22-24H,3,8-9,14-19H2 |
| InChIKey | OXPGGRYWDZYIJD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |