C21H26BrNO2 — CID 67518430
(1-ethylpiperidin-3-yl) 2,2-diphenylacetate;hydrobromide (PubChem CID 67518430) has the molecular formula C21H26BrNO2 and a molecular weight of 404.35 g/mol. Its IUPAC name is (1-ethylpiperidin-3-yl) 2,2-diphenylacetate;hydrobromide.
| Compound Name | (1-ethylpiperidin-3-yl) 2,2-diphenylacetate;hydrobromide |
|---|---|
| PubChem CID | 67518430 |
| Molecular Formula | C21H26BrNO2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (1-ethylpiperidin-3-yl) 2,2-diphenylacetate;hydrobromide |
| SMILES | Br.CCN1CCCC(OC(=O)C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H25NO2.BrH/c1-2-22-15-9-14-19(16-22)24-21(23)20(17-10-5-3-6-11-17)18-12-7-4-8-13-18;/h3-8,10-13,19-20H,2,9,14-16H2,1H3;1H |
| InChIKey | CHNGJVWRCXAGTR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |