C21H34ClNO2 — CID 2928387
(1-methylpiperidin-3-yl) 3,5-ditert-butylbenzoate;hydrochloride (PubChem CID 2928387) has the molecular formula C21H34ClNO2 and a molecular weight of 367.96 g/mol. Its IUPAC name is (1-methylpiperidin-3-yl) 3,5-ditert-butylbenzoate;hydrochloride.
| Compound Name | (1-methylpiperidin-3-yl) 3,5-ditert-butylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 2928387 |
| Molecular Formula | C21H34ClNO2 |
| Molecular Weight | 367.96 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (1-methylpiperidin-3-yl) 3,5-ditert-butylbenzoate;hydrochloride |
| SMILES | CN1CCCC(OC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C1.Cl |
| InChI | InChI=1S/C21H33NO2.ClH/c1-20(2,3)16-11-15(12-17(13-16)21(4,5)6)19(23)24-18-9-8-10-22(7)14-18;/h11-13,18H,8-10,14H2,1-7H3;1H |
| InChIKey | ZDUKEQBAUWTGDN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |