About (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride
(1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride (PubChem CID 53352548) has the molecular formula C15H22ClN2O4S-
and a molecular weight of 361.87 g/mol. Its IUPAC name is (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride.
Molecular Properties
| Compound Name | (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride |
| PubChem CID | 53352548 |
| Molecular Formula | C15H22ClN2O4S- |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride |
| SMILES | CN1CCCC(OC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)C1.[Cl-] |
| InChI | InChI=1S/C15H22N2O4S.ClH/c1-16(2)22(19,20)14-8-6-12(7-9-14)15(18)21-13-5-4-10-17(3)11-13;/h6-9,13H,4-5,10-11H2,1-3H3;1H/p-1 |
| InChIKey | SECHYSMRMHNSND-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride?
The IUPAC name of (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride (CID 53352548) is (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride.
What is the SMILES notation for (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride?
The canonical SMILES for (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride is CN1CCCC(OC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)C1.[Cl-].
What is the InChIKey of (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride?
The InChIKey is SECHYSMRMHNSND-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H22N2O4S.ClH/c1-16(2)22(19,20)14-8-6-12(7-9-14)15(18)21-13-5-4-10-17(3)11-13;/h6-9,13H,4-5,10-11H2,1-3H3;1H/p-1.
What are the key properties of (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride?
(1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride has a molecular weight of 361.87 g/mol, XLogP of -1.81, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-3-yl) 4-(dimethylsulfamoyl)benzoate chloride is sourced from PubChem (CID 53352548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).