C12H14ClN3O — CID 67075692
(6-chloro-1,3-benzoxazol-2-yl)-[(3R)-pyrrolidin-3-yl]methanamine (PubChem CID 67075692) has the molecular formula C12H14ClN3O and a molecular weight of 251.72 g/mol. Its IUPAC name is (6-chloro-1,3-benzoxazol-2-yl)-[(3R)-pyrrolidin-3-yl]methanamine.
| Compound Name | (6-chloro-1,3-benzoxazol-2-yl)-[(3R)-pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 67075692 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (6-chloro-1,3-benzoxazol-2-yl)-[(3R)-pyrrolidin-3-yl]methanamine |
| SMILES | NC(c1nc2ccc(Cl)cc2o1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C12H14ClN3O/c13-8-1-2-9-10(5-8)17-12(16-9)11(14)7-3-4-15-6-7/h1-2,5,7,11,15H,3-4,6,14H2/t7-,11?/m1/s1 |
| InChIKey | QBWYECIFHIOISF-DKSCNQEISA-N |
| XLogP | 2.09 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |