C14H14ClFN2O2 — CID 66753273
2-[(S)-(4-chloro-2-fluorophenoxy)-pyrrolidin-3-ylmethyl]-1,3-oxazole (PubChem CID 66753273) has the molecular formula C14H14ClFN2O2 and a molecular weight of 296.73 g/mol. Its IUPAC name is 2-[(S)-(4-chloro-2-fluorophenoxy)-pyrrolidin-3-ylmethyl]-1,3-oxazole.
| Compound Name | 2-[(S)-(4-chloro-2-fluorophenoxy)-pyrrolidin-3-ylmethyl]-1,3-oxazole |
|---|---|
| PubChem CID | 66753273 |
| Molecular Formula | C14H14ClFN2O2 |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-[(S)-(4-chloro-2-fluorophenoxy)-pyrrolidin-3-ylmethyl]-1,3-oxazole |
| SMILES | Fc1cc(Cl)ccc1O[C@H](c1ncco1)C1CCNC1 |
| InChI | InChI=1S/C14H14ClFN2O2/c15-10-1-2-12(11(16)7-10)20-13(9-3-4-17-8-9)14-18-5-6-19-14/h1-2,5-7,9,13,17H,3-4,8H2/t9?,13-/m0/s1 |
| InChIKey | URZBCMUMNJYHTF-NCWAPJAISA-N |
| XLogP | 3.20 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |