About 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole
2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole (PubChem CID 66752330) has the molecular formula C20H25ClN2O2
and a molecular weight of 360.88 g/mol. Its IUPAC name is 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
| PubChem CID | 66752330 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.88 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
| SMILES | Clc1ccc(O[C@H](c2ncco2)[C@@H]2CCNC2)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C20H25ClN2O2/c21-16-6-7-18(17(12-16)14-4-2-1-3-5-14)25-19(15-8-9-22-13-15)20-23-10-11-24-20/h6-7,10-12,14-15,19,22H,1-5,8-9,13H2/t15-,19+/m1/s1 |
| InChIKey | OECISIDXNDGIGS-BEFAXECRSA-N |
| XLogP | 5.11 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole?
The IUPAC name of 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole (CID 66752330) is 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole.
What is the SMILES notation for 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole?
The canonical SMILES for 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole is Clc1ccc(O[C@H](c2ncco2)[C@@H]2CCNC2)c(C2CCCCC2)c1.
What is the InChIKey of 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole?
The InChIKey is OECISIDXNDGIGS-BEFAXECRSA-N. The full InChI is InChI=1S/C20H25ClN2O2/c21-16-6-7-18(17(12-16)14-4-2-1-3-5-14)25-19(15-8-9-22-13-15)20-23-10-11-24-20/h6-7,10-12,14-15,19,22H,1-5,8-9,13H2/t15-,19+/m1/s1.
What are the key properties of 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole?
2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole has a molecular weight of 360.88 g/mol, XLogP of 5.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(S)-(4-chloro-2-cyclohexylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-1,3-oxazole is sourced from PubChem (CID 66752330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).