C15H18N2O3 — CID 66752882
2-[(2-methoxyphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole (PubChem CID 66752882) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-[(2-methoxyphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole.
| Compound Name | 2-[(2-methoxyphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 66752882 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-[(2-methoxyphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
| SMILES | COc1ccccc1OC(c1ncco1)[C@H]1CCNC1 |
| InChI | InChI=1S/C15H18N2O3/c1-18-12-4-2-3-5-13(12)20-14(11-6-7-16-10-11)15-17-8-9-19-15/h2-5,8-9,11,14,16H,6-7,10H2,1H3/t11-,14?/m0/s1 |
| InChIKey | JQSOIXQFXFXWNR-ZSOXZCCMSA-N |
| XLogP | 2.41 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |