C14H12Cl2F2N2O2 — CID 87135408
2-[(2,6-dichloro-3,5-difluorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole (PubChem CID 87135408) has the molecular formula C14H12Cl2F2N2O2 and a molecular weight of 349.16 g/mol. Its IUPAC name is 2-[(2,6-dichloro-3,5-difluorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole.
| Compound Name | 2-[(2,6-dichloro-3,5-difluorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 87135408 |
| Molecular Formula | C14H12Cl2F2N2O2 |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2-[(2,6-dichloro-3,5-difluorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
| SMILES | Fc1cc(F)c(Cl)c(OC(c2ncco2)[C@H]2CCNC2)c1Cl |
| InChI | InChI=1S/C14H12Cl2F2N2O2/c15-10-8(17)5-9(18)11(16)13(10)22-12(7-1-2-19-6-7)14-20-3-4-21-14/h3-5,7,12,19H,1-2,6H2/t7-,12?/m0/s1 |
| InChIKey | WLGXILCGQPCBGD-KAJCPDDVSA-N |
| XLogP | 3.99 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|