C15H13Cl2F2N3O — CID 87472336
2-[(R)-(2,6-dichloro-3,5-difluorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]pyrimidine (PubChem CID 87472336) has the molecular formula C15H13Cl2F2N3O and a molecular weight of 360.19 g/mol. Its IUPAC name is 2-[(R)-(2,6-dichloro-3,5-difluorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]pyrimidine.
| Compound Name | 2-[(R)-(2,6-dichloro-3,5-difluorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 87472336 |
| Molecular Formula | C15H13Cl2F2N3O |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 2-[(R)-(2,6-dichloro-3,5-difluorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]pyrimidine |
| SMILES | Fc1cc(F)c(Cl)c(O[C@@H](c2ncccn2)[C@H]2CCNC2)c1Cl |
| InChI | InChI=1S/C15H13Cl2F2N3O/c16-11-9(18)6-10(19)12(17)14(11)23-13(8-2-5-20-7-8)15-21-3-1-4-22-15/h1,3-4,6,8,13,20H,2,5,7H2/t8-,13+/m0/s1 |
| InChIKey | KRGBMAPMVJXPKX-ISVAXAHUSA-N |
| XLogP | 3.79 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|