C17H16F3NO — CID 66924710
(3S)-3-[phenyl-(2,4,6-trifluorophenoxy)methyl]pyrrolidine (PubChem CID 66924710) has the molecular formula C17H16F3NO and a molecular weight of 307.32 g/mol. Its IUPAC name is (3S)-3-[phenyl-(2,4,6-trifluorophenoxy)methyl]pyrrolidine.
| Compound Name | (3S)-3-[phenyl-(2,4,6-trifluorophenoxy)methyl]pyrrolidine |
|---|---|
| PubChem CID | 66924710 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3S)-3-[phenyl-(2,4,6-trifluorophenoxy)methyl]pyrrolidine |
| SMILES | Fc1cc(F)c(OC(c2ccccc2)[C@H]2CCNC2)c(F)c1 |
| InChI | InChI=1S/C17H16F3NO/c18-13-8-14(19)17(15(20)9-13)22-16(12-6-7-21-10-12)11-4-2-1-3-5-11/h1-5,8-9,12,16,21H,6-7,10H2/t12-,16?/m0/s1 |
| InChIKey | KFIICQHBODCHBL-HKALDPMFSA-N |
| XLogP | 3.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |