C16H15F3N2O — CID 46946622
2,3,5-trifluoro-6-[(R)-phenyl-[(3S)-pyrrolidin-3-yl]methoxy]pyridine (PubChem CID 46946622) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is 2,3,5-trifluoro-6-[(R)-phenyl-[(3S)-pyrrolidin-3-yl]methoxy]pyridine.
| Compound Name | 2,3,5-trifluoro-6-[(R)-phenyl-[(3S)-pyrrolidin-3-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 46946622 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2,3,5-trifluoro-6-[(R)-phenyl-[(3S)-pyrrolidin-3-yl]methoxy]pyridine |
| SMILES | Fc1cc(F)c(O[C@@H](c2ccccc2)[C@H]2CCNC2)nc1F |
| InChI | InChI=1S/C16H15F3N2O/c17-12-8-13(18)16(21-15(12)19)22-14(11-6-7-20-9-11)10-4-2-1-3-5-10/h1-5,8,11,14,20H,6-7,9H2/t11-,14-/m0/s1 |
| InChIKey | OBNIWEGCIDZILD-FZMZJTMJSA-N |
| XLogP | 3.23 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|