C17H14F3N3O — CID 66752292
2,3,5-trifluoro-6-[phenyl-[(3S)-pyrrolidin-3-yl]methoxy]pyridine-4-carbonitrile (PubChem CID 66752292) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is 2,3,5-trifluoro-6-[phenyl-[(3S)-pyrrolidin-3-yl]methoxy]pyridine-4-carbonitrile.
| Compound Name | 2,3,5-trifluoro-6-[phenyl-[(3S)-pyrrolidin-3-yl]methoxy]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 66752292 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2,3,5-trifluoro-6-[phenyl-[(3S)-pyrrolidin-3-yl]methoxy]pyridine-4-carbonitrile |
| SMILES | N#Cc1c(F)c(F)nc(OC(c2ccccc2)[C@H]2CCNC2)c1F |
| InChI | InChI=1S/C17H14F3N3O/c18-13-12(8-21)14(19)17(23-16(13)20)24-15(11-6-7-22-9-11)10-4-2-1-3-5-10/h1-5,11,15,22H,6-7,9H2/t11-,15?/m0/s1 |
| InChIKey | OGVMROLNKYFNPD-VPHXOMNUSA-N |
| XLogP | 3.10 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|