C16H14Cl2F2N2O — CID 87135446
2,4-dichloro-3,5-difluoro-6-[(S)-phenyl(pyrrolidin-3-yl)methoxy]pyridine (PubChem CID 87135446) has the molecular formula C16H14Cl2F2N2O and a molecular weight of 359.20 g/mol. Its IUPAC name is 2,4-dichloro-3,5-difluoro-6-[(S)-phenyl(pyrrolidin-3-yl)methoxy]pyridine.
| Compound Name | 2,4-dichloro-3,5-difluoro-6-[(S)-phenyl(pyrrolidin-3-yl)methoxy]pyridine |
|---|---|
| PubChem CID | 87135446 |
| Molecular Formula | C16H14Cl2F2N2O |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2,4-dichloro-3,5-difluoro-6-[(S)-phenyl(pyrrolidin-3-yl)methoxy]pyridine |
| SMILES | Fc1c(Cl)nc(O[C@H](c2ccccc2)C2CCNC2)c(F)c1Cl |
| InChI | InChI=1S/C16H14Cl2F2N2O/c17-11-12(19)15(18)22-16(13(11)20)23-14(10-6-7-21-8-10)9-4-2-1-3-5-9/h1-5,10,14,21H,6-8H2/t10?,14-/m1/s1 |
| InChIKey | DOTGCCHTAVCQRG-LNUXAPHWSA-N |
| XLogP | 4.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|