C16H16Cl2N2O — CID 66752614
3,5-dichloro-2-[(S)-phenyl-[(3R)-pyrrolidin-3-yl]methoxy]pyridine (PubChem CID 66752614) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 3,5-dichloro-2-[(S)-phenyl-[(3R)-pyrrolidin-3-yl]methoxy]pyridine.
| Compound Name | 3,5-dichloro-2-[(S)-phenyl-[(3R)-pyrrolidin-3-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 66752614 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3,5-dichloro-2-[(S)-phenyl-[(3R)-pyrrolidin-3-yl]methoxy]pyridine |
| SMILES | Clc1cnc(O[C@H](c2ccccc2)[C@@H]2CCNC2)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2O/c17-13-8-14(18)16(20-10-13)21-15(12-6-7-19-9-12)11-4-2-1-3-5-11/h1-5,8,10,12,15,19H,6-7,9H2/t12-,15-/m1/s1 |
| InChIKey | FJEXZPXBKFOYOM-IUODEOHRSA-N |
| XLogP | 4.12 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |