C18H19ClFNO — CID 76807736
3-[(2-chloro-6-fluoro-3-methylphenoxy)-phenylmethyl]pyrrolidine (PubChem CID 76807736) has the molecular formula C18H19ClFNO and a molecular weight of 319.81 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluoro-3-methylphenoxy)-phenylmethyl]pyrrolidine.
| Compound Name | 3-[(2-chloro-6-fluoro-3-methylphenoxy)-phenylmethyl]pyrrolidine |
|---|---|
| PubChem CID | 76807736 |
| Molecular Formula | C18H19ClFNO |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 3-[(2-chloro-6-fluoro-3-methylphenoxy)-phenylmethyl]pyrrolidine |
| SMILES | Cc1ccc(F)c(OC(c2ccccc2)C2CCNC2)c1Cl |
| InChI | InChI=1S/C18H19ClFNO/c1-12-7-8-15(20)18(16(12)19)22-17(14-9-10-21-11-14)13-5-3-2-4-6-13/h2-8,14,17,21H,9-11H2,1H3 |
| InChIKey | GMQZKMJHEVALSS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |