C13H16ClF2NO — CID 66891700
3-[(1S)-1-(2-chloro-3,6-difluorophenoxy)propyl]pyrrolidine (PubChem CID 66891700) has the molecular formula C13H16ClF2NO and a molecular weight of 275.73 g/mol. Its IUPAC name is 3-[(1S)-1-(2-chloro-3,6-difluorophenoxy)propyl]pyrrolidine.
| Compound Name | 3-[(1S)-1-(2-chloro-3,6-difluorophenoxy)propyl]pyrrolidine |
|---|---|
| PubChem CID | 66891700 |
| Molecular Formula | C13H16ClF2NO |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[(1S)-1-(2-chloro-3,6-difluorophenoxy)propyl]pyrrolidine |
| SMILES | CC[C@H](Oc1c(F)ccc(F)c1Cl)C1CCNC1 |
| InChI | InChI=1S/C13H16ClF2NO/c1-2-11(8-5-6-17-7-8)18-13-10(16)4-3-9(15)12(13)14/h3-4,8,11,17H,2,5-7H2,1H3/t8?,11-/m0/s1 |
| InChIKey | BBHNNQSLTXIODP-LYNSQETBSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|