C15H20ClF2NO — CID 66848802
(3S)-3-[(1S)-1-(3-chloro-2,6-difluorophenoxy)-3-methylbutyl]pyrrolidine (PubChem CID 66848802) has the molecular formula C15H20ClF2NO and a molecular weight of 303.78 g/mol. Its IUPAC name is (3S)-3-[(1S)-1-(3-chloro-2,6-difluorophenoxy)-3-methylbutyl]pyrrolidine.
| Compound Name | (3S)-3-[(1S)-1-(3-chloro-2,6-difluorophenoxy)-3-methylbutyl]pyrrolidine |
|---|---|
| PubChem CID | 66848802 |
| Molecular Formula | C15H20ClF2NO |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (3S)-3-[(1S)-1-(3-chloro-2,6-difluorophenoxy)-3-methylbutyl]pyrrolidine |
| SMILES | CC(C)C[C@H](Oc1c(F)ccc(Cl)c1F)[C@H]1CCNC1 |
| InChI | InChI=1S/C15H20ClF2NO/c1-9(2)7-13(10-5-6-19-8-10)20-15-12(17)4-3-11(16)14(15)18/h3-4,9-10,13,19H,5-8H2,1-2H3/t10-,13-/m0/s1 |
| InChIKey | PGZDHZQGCACLSK-GWCFXTLKSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|