C15H21Cl2NO2 — CID 66860095
(3R)-3-[(1S)-1-(2,6-dichlorophenoxy)-2-propan-2-yloxyethyl]pyrrolidine (PubChem CID 66860095) has the molecular formula C15H21Cl2NO2 and a molecular weight of 318.24 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-(2,6-dichlorophenoxy)-2-propan-2-yloxyethyl]pyrrolidine.
| Compound Name | (3R)-3-[(1S)-1-(2,6-dichlorophenoxy)-2-propan-2-yloxyethyl]pyrrolidine |
|---|---|
| PubChem CID | 66860095 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (3R)-3-[(1S)-1-(2,6-dichlorophenoxy)-2-propan-2-yloxyethyl]pyrrolidine |
| SMILES | CC(C)OC[C@@H](Oc1c(Cl)cccc1Cl)[C@@H]1CCNC1 |
| InChI | InChI=1S/C15H21Cl2NO2/c1-10(2)19-9-14(11-6-7-18-8-11)20-15-12(16)4-3-5-13(15)17/h3-5,10-11,14,18H,6-9H2,1-2H3/t11-,14-/m1/s1 |
| InChIKey | VHMFBAMJZFWLFT-BXUZGUMPSA-N |
| XLogP | 3.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |