C13H17Cl2NOS — CID 66848829
3-[(1S)-1-(2,3-dichlorophenoxy)-2-methylsulfanylethyl]pyrrolidine (PubChem CID 66848829) has the molecular formula C13H17Cl2NOS and a molecular weight of 306.26 g/mol. Its IUPAC name is 3-[(1S)-1-(2,3-dichlorophenoxy)-2-methylsulfanylethyl]pyrrolidine.
| Compound Name | 3-[(1S)-1-(2,3-dichlorophenoxy)-2-methylsulfanylethyl]pyrrolidine |
|---|---|
| PubChem CID | 66848829 |
| Molecular Formula | C13H17Cl2NOS |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-[(1S)-1-(2,3-dichlorophenoxy)-2-methylsulfanylethyl]pyrrolidine |
| SMILES | CSC[C@@H](Oc1cccc(Cl)c1Cl)C1CCNC1 |
| InChI | InChI=1S/C13H17Cl2NOS/c1-18-8-12(9-5-6-16-7-9)17-11-4-2-3-10(14)13(11)15/h2-4,9,12,16H,5-8H2,1H3/t9?,12-/m1/s1 |
| InChIKey | ANTIMTRQNKZZGY-FFFFSGIJSA-N |
| XLogP | 3.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |