C19H21Cl2NO2 — CID 66859718
(3S)-3-[(1R)-1-(2,3-dichlorophenoxy)-2-phenylmethoxyethyl]pyrrolidine (PubChem CID 66859718) has the molecular formula C19H21Cl2NO2 and a molecular weight of 366.29 g/mol. Its IUPAC name is (3S)-3-[(1R)-1-(2,3-dichlorophenoxy)-2-phenylmethoxyethyl]pyrrolidine.
| Compound Name | (3S)-3-[(1R)-1-(2,3-dichlorophenoxy)-2-phenylmethoxyethyl]pyrrolidine |
|---|---|
| PubChem CID | 66859718 |
| Molecular Formula | C19H21Cl2NO2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (3S)-3-[(1R)-1-(2,3-dichlorophenoxy)-2-phenylmethoxyethyl]pyrrolidine |
| SMILES | Clc1cccc(O[C@@H](COCc2ccccc2)[C@H]2CCNC2)c1Cl |
| InChI | InChI=1S/C19H21Cl2NO2/c20-16-7-4-8-17(19(16)21)24-18(15-9-10-22-11-15)13-23-12-14-5-2-1-3-6-14/h1-8,15,18,22H,9-13H2/t15-,18-/m0/s1 |
| InChIKey | BSWALRCCZJSATB-YJBOKZPZSA-N |
| XLogP | 4.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |