C16H22F3NO2 — CID 66859167
(3S)-3-[(1R)-2-propan-2-yloxy-1-[3-(trifluoromethyl)phenoxy]ethyl]pyrrolidine (PubChem CID 66859167) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is (3S)-3-[(1R)-2-propan-2-yloxy-1-[3-(trifluoromethyl)phenoxy]ethyl]pyrrolidine.
| Compound Name | (3S)-3-[(1R)-2-propan-2-yloxy-1-[3-(trifluoromethyl)phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 66859167 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (3S)-3-[(1R)-2-propan-2-yloxy-1-[3-(trifluoromethyl)phenoxy]ethyl]pyrrolidine |
| SMILES | CC(C)OC[C@H](Oc1cccc(C(F)(F)F)c1)[C@H]1CCNC1 |
| InChI | InChI=1S/C16H22F3NO2/c1-11(2)21-10-15(12-6-7-20-9-12)22-14-5-3-4-13(8-14)16(17,18)19/h3-5,8,11-12,15,20H,6-7,9-10H2,1-2H3/t12-,15-/m0/s1 |
| InChIKey | SBFLJCKFLPTCOQ-WFASDCNBSA-N |
| XLogP | 3.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |