C15H20F3NOS — CID 66861082
3-[(1R)-2-ethylsulfanyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine (PubChem CID 66861082) has the molecular formula C15H20F3NOS and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-[(1R)-2-ethylsulfanyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine.
| Compound Name | 3-[(1R)-2-ethylsulfanyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 66861082 |
| Molecular Formula | C15H20F3NOS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-[(1R)-2-ethylsulfanyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine |
| SMILES | CCSC[C@H](Oc1ccc(C(F)(F)F)cc1)C1CCNC1 |
| InChI | InChI=1S/C15H20F3NOS/c1-2-21-10-14(11-7-8-19-9-11)20-13-5-3-12(4-6-13)15(16,17)18/h3-6,11,14,19H,2,7-10H2,1H3/t11?,14-/m0/s1 |
| InChIKey | QOYLRDCVCBYEBG-IAXJKZSUSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |