C19H21F3N2O3S — CID 67774785
N-[(2R)-2-[(3S)-pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethyl]benzenesulfonamide (PubChem CID 67774785) has the molecular formula C19H21F3N2O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is N-[(2R)-2-[(3S)-pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethyl]benzenesulfonamide.
| Compound Name | N-[(2R)-2-[(3S)-pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67774785 |
| Molecular Formula | C19H21F3N2O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[(2R)-2-[(3S)-pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@H](Oc1ccc(C(F)(F)F)cc1)[C@H]1CCNC1)c1ccccc1 |
| InChI | InChI=1S/C19H21F3N2O3S/c20-19(21,22)15-6-8-16(9-7-15)27-18(14-10-11-23-12-14)13-24-28(25,26)17-4-2-1-3-5-17/h1-9,14,18,23-24H,10-13H2/t14-,18-/m0/s1 |
| InChIKey | RBTSHNZTXBPOCO-KSSFIOAISA-N |
| XLogP | 3.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |