C20H23F3N2O3S — CID 67775295
(2S)-N-benzyl-2-[(3S)-pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethanesulfonamide (PubChem CID 67775295) has the molecular formula C20H23F3N2O3S and a molecular weight of 428.48 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[(3S)-pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethanesulfonamide.
| Compound Name | (2S)-N-benzyl-2-[(3S)-pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethanesulfonamide |
|---|---|
| PubChem CID | 67775295 |
| Molecular Formula | C20H23F3N2O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (2S)-N-benzyl-2-[(3S)-pyrrolidin-3-yl]-2-[4-(trifluoromethyl)phenoxy]ethanesulfonamide |
| SMILES | O=S(=O)(C[C@@H](Oc1ccc(C(F)(F)F)cc1)[C@H]1CCNC1)NCc1ccccc1 |
| InChI | InChI=1S/C20H23F3N2O3S/c21-20(22,23)17-6-8-18(9-7-17)28-19(16-10-11-24-13-16)14-29(26,27)25-12-15-4-2-1-3-5-15/h1-9,16,19,24-25H,10-14H2/t16-,19+/m0/s1 |
| InChIKey | MFGSNZLVQBCXBS-QFBILLFUSA-N |
| XLogP | 3.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |