About (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate
(3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate (PubChem CID 66974891) has the molecular formula C14H20F3NO4S
and a molecular weight of 355.38 g/mol. Its IUPAC name is (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate.
Molecular Properties
| Compound Name | (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate |
| PubChem CID | 66974891 |
| Molecular Formula | C14H20F3NO4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate |
| SMILES | CS(=O)(=O)C[C@@H](Oc1ccc(C(F)(F)F)cc1)[C@H]1CCNC1.O |
| InChI | InChI=1S/C14H18F3NO3S.H2O/c1-22(19,20)9-13(10-6-7-18-8-10)21-12-4-2-11(3-5-12)14(15,16)17;/h2-5,10,13,18H,6-9H2,1H3;1H2/t10-,13+;/m0./s1 |
| InChIKey | PFPXZNVJDYJFNM-SMDQHNSPSA-N |
| XLogP | 1.28 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate?
The IUPAC name of (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate (CID 66974891) is (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate.
What is the SMILES notation for (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate?
The canonical SMILES for (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate is CS(=O)(=O)C[C@@H](Oc1ccc(C(F)(F)F)cc1)[C@H]1CCNC1.O.
What is the InChIKey of (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate?
The InChIKey is PFPXZNVJDYJFNM-SMDQHNSPSA-N. The full InChI is InChI=1S/C14H18F3NO3S.H2O/c1-22(19,20)9-13(10-6-7-18-8-10)21-12-4-2-11(3-5-12)14(15,16)17;/h2-5,10,13,18H,6-9H2,1H3;1H2/t10-,13+;/m0./s1.
What are the key properties of (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate?
(3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate has a molecular weight of 355.38 g/mol, XLogP of 1.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine;hydrate is sourced from PubChem (CID 66974891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).