C14H18F3NO4S — CID 66974872
(3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethoxy)phenoxy]ethyl]pyrrolidine (PubChem CID 66974872) has the molecular formula C14H18F3NO4S and a molecular weight of 353.36 g/mol. Its IUPAC name is (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethoxy)phenoxy]ethyl]pyrrolidine.
| Compound Name | (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethoxy)phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 66974872 |
| Molecular Formula | C14H18F3NO4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (3S)-3-[(1S)-2-methylsulfonyl-1-[4-(trifluoromethoxy)phenoxy]ethyl]pyrrolidine |
| SMILES | CS(=O)(=O)C[C@@H](Oc1ccc(OC(F)(F)F)cc1)[C@H]1CCNC1 |
| InChI | InChI=1S/C14H18F3NO4S/c1-23(19,20)9-13(10-6-7-18-8-10)21-11-2-4-12(5-3-11)22-14(15,16)17/h2-5,10,13,18H,6-9H2,1H3/t10-,13+/m0/s1 |
| InChIKey | RIHPAUMANUORNV-GXFFZTMASA-N |
| XLogP | 1.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |