C15H17F3N2O3S — CID 71744689
3-[(1S)-2-methylsulfonyl-1-[(3R)-pyrrolidin-3-yl]ethoxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 71744689) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is 3-[(1S)-2-methylsulfonyl-1-[(3R)-pyrrolidin-3-yl]ethoxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[(1S)-2-methylsulfonyl-1-[(3R)-pyrrolidin-3-yl]ethoxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 71744689 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 3-[(1S)-2-methylsulfonyl-1-[(3R)-pyrrolidin-3-yl]ethoxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | CS(=O)(=O)C[C@@H](Oc1cccc(C#N)c1C(F)(F)F)[C@@H]1CCNC1 |
| InChI | InChI=1S/C15H17F3N2O3S/c1-24(21,22)9-13(11-5-6-20-8-11)23-12-4-2-3-10(7-19)14(12)15(16,17)18/h2-4,11,13,20H,5-6,8-9H2,1H3/t11-,13-/m1/s1 |
| InChIKey | SSUTUDBPZWKASM-DGCLKSJQSA-N |
| XLogP | 1.98 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |