C16H21Cl2NO2 — CID 66860705
(3R)-3-[(R)-(2,6-dichlorophenoxy)-(oxan-4-yl)methyl]pyrrolidine (PubChem CID 66860705) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.25 g/mol. Its IUPAC name is (3R)-3-[(R)-(2,6-dichlorophenoxy)-(oxan-4-yl)methyl]pyrrolidine.
| Compound Name | (3R)-3-[(R)-(2,6-dichlorophenoxy)-(oxan-4-yl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 66860705 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (3R)-3-[(R)-(2,6-dichlorophenoxy)-(oxan-4-yl)methyl]pyrrolidine |
| SMILES | Clc1cccc(Cl)c1O[C@H](C1CCOCC1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C16H21Cl2NO2/c17-13-2-1-3-14(18)16(13)21-15(12-4-7-19-10-12)11-5-8-20-9-6-11/h1-3,11-12,15,19H,4-10H2/t12-,15-/m1/s1 |
| InChIKey | XUMAZFLUWBCSIS-IUODEOHRSA-N |
| XLogP | 3.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |