About 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine
3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine (PubChem CID 66889861) has the molecular formula C13H16ClF2NO
and a molecular weight of 275.73 g/mol. Its IUPAC name is 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine.
Molecular Properties
| Compound Name | 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine |
| PubChem CID | 66889861 |
| Molecular Formula | C13H16ClF2NO |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine |
| SMILES | CC[C@H](Oc1c(F)cc(Cl)cc1F)C1CCNC1 |
| InChI | InChI=1S/C13H16ClF2NO/c1-2-12(8-3-4-17-7-8)18-13-10(15)5-9(14)6-11(13)16/h5-6,8,12,17H,2-4,7H2,1H3/t8?,12-/m0/s1 |
| InChIKey | IMMYOXIUNMIMCC-MYIOLCAUSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine?
The IUPAC name of 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine (CID 66889861) is 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine.
What is the SMILES notation for 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine?
The canonical SMILES for 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine is CC[C@H](Oc1c(F)cc(Cl)cc1F)C1CCNC1.
What is the InChIKey of 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine?
The InChIKey is IMMYOXIUNMIMCC-MYIOLCAUSA-N. The full InChI is InChI=1S/C13H16ClF2NO/c1-2-12(8-3-4-17-7-8)18-13-10(15)5-9(14)6-11(13)16/h5-6,8,12,17H,2-4,7H2,1H3/t8?,12-/m0/s1.
What are the key properties of 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine?
3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine has a molecular weight of 275.73 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-1-(4-chloro-2,6-difluorophenoxy)propyl]pyrrolidine is sourced from PubChem (CID 66889861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).