C16H15ClF2N2O — CID 66752357
3-[(S)-(4-chloro-2,6-difluorophenoxy)-pyrrolidin-3-ylmethyl]pyridine (PubChem CID 66752357) has the molecular formula C16H15ClF2N2O and a molecular weight of 324.76 g/mol. Its IUPAC name is 3-[(S)-(4-chloro-2,6-difluorophenoxy)-pyrrolidin-3-ylmethyl]pyridine.
| Compound Name | 3-[(S)-(4-chloro-2,6-difluorophenoxy)-pyrrolidin-3-ylmethyl]pyridine |
|---|---|
| PubChem CID | 66752357 |
| Molecular Formula | C16H15ClF2N2O |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3-[(S)-(4-chloro-2,6-difluorophenoxy)-pyrrolidin-3-ylmethyl]pyridine |
| SMILES | Fc1cc(Cl)cc(F)c1O[C@H](c1cccnc1)C1CCNC1 |
| InChI | InChI=1S/C16H15ClF2N2O/c17-12-6-13(18)16(14(19)7-12)22-15(11-3-5-21-9-11)10-2-1-4-20-8-10/h1-2,4,6-8,11,15,21H,3,5,9H2/t11?,15-/m1/s1 |
| InChIKey | ZHCKSHGLEPZYFU-JOPIAHFSSA-N |
| XLogP | 3.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |