C16H15ClF2N2O — CID 66752232
3-[(S)-(4-chloro-2-fluorophenoxy)-pyrrolidin-3-ylmethyl]-5-fluoropyridine (PubChem CID 66752232) has the molecular formula C16H15ClF2N2O and a molecular weight of 324.76 g/mol. Its IUPAC name is 3-[(S)-(4-chloro-2-fluorophenoxy)-pyrrolidin-3-ylmethyl]-5-fluoropyridine.
| Compound Name | 3-[(S)-(4-chloro-2-fluorophenoxy)-pyrrolidin-3-ylmethyl]-5-fluoropyridine |
|---|---|
| PubChem CID | 66752232 |
| Molecular Formula | C16H15ClF2N2O |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3-[(S)-(4-chloro-2-fluorophenoxy)-pyrrolidin-3-ylmethyl]-5-fluoropyridine |
| SMILES | Fc1cncc([C@@H](Oc2ccc(Cl)cc2F)C2CCNC2)c1 |
| InChI | InChI=1S/C16H15ClF2N2O/c17-12-1-2-15(14(19)6-12)22-16(10-3-4-20-7-10)11-5-13(18)9-21-8-11/h1-2,5-6,8-10,16,20H,3-4,7H2/t10?,16-/m0/s1 |
| InChIKey | BQBJMHXQPNDVFW-CSPPYYTDSA-N |
| XLogP | 3.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |