About 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine
3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine (PubChem CID 66752590) has the molecular formula C17H17Cl2FN2O
and a molecular weight of 355.24 g/mol. Its IUPAC name is 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine.
Molecular Properties
| Compound Name | 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine |
| PubChem CID | 66752590 |
| Molecular Formula | C17H17Cl2FN2O |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine |
| SMILES | Cc1cc(Cl)c(O[C@H](c2cncc(F)c2)[C@@H]2CCNC2)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2FN2O/c1-10-4-14(18)17(15(19)5-10)23-16(11-2-3-21-7-11)12-6-13(20)9-22-8-12/h4-6,8-9,11,16,21H,2-3,7H2,1H3/t11-,16+/m1/s1 |
| InChIKey | NMXSFJAIAKLDKX-BZNIZROVSA-N |
| XLogP | 4.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine?
The IUPAC name of 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine (CID 66752590) is 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine.
What is the SMILES notation for 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine?
The canonical SMILES for 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine is Cc1cc(Cl)c(O[C@H](c2cncc(F)c2)[C@@H]2CCNC2)c(Cl)c1.
What is the InChIKey of 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine?
The InChIKey is NMXSFJAIAKLDKX-BZNIZROVSA-N. The full InChI is InChI=1S/C17H17Cl2FN2O/c1-10-4-14(18)17(15(19)5-10)23-16(11-2-3-21-7-11)12-6-13(20)9-22-8-12/h4-6,8-9,11,16,21H,2-3,7H2,1H3/t11-,16+/m1/s1.
What are the key properties of 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine?
3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine has a molecular weight of 355.24 g/mol, XLogP of 4.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(S)-(2,6-dichloro-4-methylphenoxy)-[(3R)-pyrrolidin-3-yl]methyl]-5-fluoropyridine is sourced from PubChem (CID 66752590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).