C16H15F3N2O — CID 66752414
3-[[(3R)-pyrrolidin-3-yl]-(2,4,6-trifluorophenoxy)methyl]pyridine (PubChem CID 66752414) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is 3-[[(3R)-pyrrolidin-3-yl]-(2,4,6-trifluorophenoxy)methyl]pyridine.
| Compound Name | 3-[[(3R)-pyrrolidin-3-yl]-(2,4,6-trifluorophenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 66752414 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-[[(3R)-pyrrolidin-3-yl]-(2,4,6-trifluorophenoxy)methyl]pyridine |
| SMILES | Fc1cc(F)c(OC(c2cccnc2)[C@@H]2CCNC2)c(F)c1 |
| InChI | InChI=1S/C16H15F3N2O/c17-12-6-13(18)16(14(19)7-12)22-15(11-3-5-21-9-11)10-2-1-4-20-8-10/h1-2,4,6-8,11,15,21H,3,5,9H2/t11-,15?/m1/s1 |
| InChIKey | YSCAUYGVBBPKSI-ZRKZCGFPSA-N |
| XLogP | 3.23 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |