C16H14Cl4N2O — CID 75246264
3-chloro-5-[pyrrolidin-3-yl-(2,4,5-trichlorophenoxy)methyl]pyridine (PubChem CID 75246264) has the molecular formula C16H14Cl4N2O and a molecular weight of 392.11 g/mol. Its IUPAC name is 3-chloro-5-[pyrrolidin-3-yl-(2,4,5-trichlorophenoxy)methyl]pyridine.
| Compound Name | 3-chloro-5-[pyrrolidin-3-yl-(2,4,5-trichlorophenoxy)methyl]pyridine |
|---|---|
| PubChem CID | 75246264 |
| Molecular Formula | C16H14Cl4N2O |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 3-chloro-5-[pyrrolidin-3-yl-(2,4,5-trichlorophenoxy)methyl]pyridine |
| SMILES | Clc1cncc(C(Oc2cc(Cl)c(Cl)cc2Cl)C2CCNC2)c1 |
| InChI | InChI=1S/C16H14Cl4N2O/c17-11-3-10(7-22-8-11)16(9-1-2-21-6-9)23-15-5-13(19)12(18)4-14(15)20/h3-5,7-9,16,21H,1-2,6H2 |
| InChIKey | MUELLZCKOHXFHL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|