About (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine
(3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine (PubChem CID 66892236) has the molecular formula C15H21Cl2NO
and a molecular weight of 302.25 g/mol. Its IUPAC name is (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine.
Molecular Properties
| Compound Name | (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine |
| PubChem CID | 66892236 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine |
| SMILES | CC(C)C[C@H](Oc1cc(Cl)cc(Cl)c1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-10(2)5-15(11-3-4-18-9-11)19-14-7-12(16)6-13(17)8-14/h6-8,10-11,15,18H,3-5,9H2,1-2H3/t11-,15+/m1/s1 |
| InChIKey | UXKDOSHWWUDGPB-ABAIWWIYSA-N |
| XLogP | 4.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine?
The IUPAC name of (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine (CID 66892236) is (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine.
What is the SMILES notation for (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine?
The canonical SMILES for (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine is CC(C)C[C@H](Oc1cc(Cl)cc(Cl)c1)[C@@H]1CCNC1.
What is the InChIKey of (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine?
The InChIKey is UXKDOSHWWUDGPB-ABAIWWIYSA-N. The full InChI is InChI=1S/C15H21Cl2NO/c1-10(2)5-15(11-3-4-18-9-11)19-14-7-12(16)6-13(17)8-14/h6-8,10-11,15,18H,3-5,9H2,1-2H3/t11-,15+/m1/s1.
What are the key properties of (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine?
(3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine has a molecular weight of 302.25 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(1S)-1-(3,5-dichlorophenoxy)-3-methylbutyl]pyrrolidine is sourced from PubChem (CID 66892236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).