C14H14Cl2N2O2 — CID 66752243
2-[(2,3-dichlorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole (PubChem CID 66752243) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole.
| Compound Name | 2-[(2,3-dichlorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 66752243 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[(2,3-dichlorophenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
| SMILES | Clc1cccc(OC(c2ncco2)[C@H]2CCNC2)c1Cl |
| InChI | InChI=1S/C14H14Cl2N2O2/c15-10-2-1-3-11(12(10)16)20-13(9-4-5-17-8-9)14-18-6-7-19-14/h1-3,6-7,9,13,17H,4-5,8H2/t9-,13?/m0/s1 |
| InChIKey | CCJONAALTPMHBC-LLTODGECSA-N |
| XLogP | 3.71 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |