C15H18N2O2 — CID 66752684
2-[(R)-(2-methylphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole (PubChem CID 66752684) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[(R)-(2-methylphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole.
| Compound Name | 2-[(R)-(2-methylphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 66752684 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-[(R)-(2-methylphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
| SMILES | Cc1ccccc1O[C@@H](c1ncco1)[C@H]1CCNC1 |
| InChI | InChI=1S/C15H18N2O2/c1-11-4-2-3-5-13(11)19-14(12-6-7-16-10-12)15-17-8-9-18-15/h2-5,8-9,12,14,16H,6-7,10H2,1H3/t12-,14+/m0/s1 |
| InChIKey | WQTSOUIUSONWNK-GXTWGEPZSA-N |
| XLogP | 2.71 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |