C20H20N2O2 — CID 66752960
2-[(2-phenylphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole (PubChem CID 66752960) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[(2-phenylphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole.
| Compound Name | 2-[(2-phenylphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 66752960 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-[(2-phenylphenoxy)-[(3S)-pyrrolidin-3-yl]methyl]-1,3-oxazole |
| SMILES | c1ccc(-c2ccccc2OC(c2ncco2)[C@H]2CCNC2)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-2-6-15(7-3-1)17-8-4-5-9-18(17)24-19(16-10-11-21-14-16)20-22-12-13-23-20/h1-9,12-13,16,19,21H,10-11,14H2/t16-,19?/m0/s1 |
| InChIKey | FMHZGNJHALSDMA-UCFFOFKASA-N |
| XLogP | 4.07 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |